50076830 50076830

28-10-2021
Health

contestada

Which foods and exercises can best help a person prevent osteoporosis?

Respuesta :

danyellamiller936 danyellamiller936

28-10-2021

Dairy: milk, yogurt, cheese, and calcium-fortified
Green/leafy vegetables: broccoli, kale, collard greens, etc.. are good foods

Answer Link

Otras preguntas

Which of the following outlines the five-step process used to determine eligibility for a Desk Appearance Ticket (DAT)? a) Initial arrest, background check, con

How did Latin American countries respond to European ideas of White superiority? a) Creating anti-miscegenation laws. b) Banning Europeans from entering. c) Ar

The system of resources used as a channel for communication, such as the internet, for groups of people to connect is called: a) Network b) Medium c) Platform d

What players are considered "in the free blocking zone"? a) Offensive linemen b) Defensive linemen c) Receivers d) Quarterbacks

Label all the NMR peaks in proton NMR. In IR, label at least one band which helped you to identify the compound. Molecular Formula: C_(6)H_(7)N STRUCTURE: A. 1

Provide the correct IUPAC names for the following compounds. a) CH3CH2CH(C2H5)C(CH3)2CH2CH3 A) 3-Ethyl-2-methylhexane B) 4-Ethyl-3-methylpentane C) 2-Methyl-3

How many moles of copper sulfate are used to produce the solution in this experiment? a. 12.58g b. 63.5g c. 31.75g d. 25.16g

As you would expect, the potential difference across capacitors connected in parallel is the same individually as the potential at the junction.Δv = Δv₁ = Δv₂ =

Francis heard that a car stereo system was on sale for 30% off if the salfe price is 57.75 what was the price of the original cost

Of the followingwhich is a reason we take samples instead of taking a census?a) Census is a hard word to say.b) A census is not reliable.c) A census doesn't giv