mccole7802 mccole7802

18-02-2024
Chemistry

contestada

Provide the correct IUPAC names for the following compounds.

a) CH3CH2CH(C2H5)C(CH3)2CH2CH3

A) 3-Ethyl-2-methylhexane
B) 4-Ethyl-3-methylpentane
C) 2-Methyl-3-ethylpentane
D) 5-Ethyl-4-methylheptane

Respuesta :

Otras preguntas

which of the following describes white space figure foreground positive space negative space

AWord1 dsconcertina2 centSynonymb eCoor4 simplisticfeesuppressnoticeescapeemain1. dingyabstaincleanforHigiesippantrecuperate90 disorientedا سبانيامنconfused I s

Conflict is considered to be dysfunctional when:A. it involves alternative dispute resolution.B. it hinders organizational performance.C. it involves the compro

Audacity is blank program that is free to download and is used by tens of millions of people worldwide.

write an equivalent expression to 6a - 3b - 8 + 7b - 2a

Where in the cell cycle is the cell's DNA actually copied?

What does the word “state” mean in the sentence?

Which best describes Paris’s reaction when he believes that Juliet has died? He’s angry that the friar gave her poison. He’s relieved that the wedding is cancel

What is the relationship between the structure of an enzyme and it’s function?

Erica está aprendiendo a tocar la guitarra. A ella le gusta mucho la música popular, pero no puede tocar como los grandes profesionales todavía. Ella quiere ser

ACCESS MORE