nikexcarrion nikexcarrion
  • 17-11-2020
  • Mathematics
contestada

What is the trend of this graph?

What is the trend of this graph class=

Respuesta :

ryancurley21
ryancurley21 ryancurley21
  • 17-11-2020

Answer:

There are less bubbles the further down you go

Step-by-step explanation:

Answer Link

Otras preguntas

in the reaction HCl + KOH KCL + H2O, the spectator ions are
What element increases after giving a pint of blood?
What is produced when a yeast cell undergoes fermentation?. A] Ethyl alcohol. B] Pyruvate . C] Oxygen gas. D] Lactic acid.
Match each statement to the correct term. If two angles add to 90°, then they are complementary.. 1. converse. 2. inverse. 3. contrapositive. . If two angles ar
How are cells in a multicellular organism able to achieve homeostasis? . A. They are uniform in function and work independently from one another.. B. They are s
Which of the following is a major cause of waterborne diseases?. A) Bacteria. B) Particulates. C) Dissolved gases. D) Sediments
What is the 22nd term of the arithmetic sequence where a1 = 8 and a9 = 56 ?
Write the expression as either the sine, cosine, or tangent of a single angle. sin(pi/2)cos(pi/7)+cos(pi/2)sin(pi/7)
Why did political instability plague many developing nations?
Please answer these questions
ACCESS MORE