madelinecelesteclegg
madelinecelesteclegg madelinecelesteclegg
  • 28-04-2020
  • History
contestada

What are two characteristics of Hinduism?

A Christmas and church
B Ramadan and praying five times a day
C Karma and reincarnation
D Star of David and Hanukkah

Respuesta :

jordynminnis
jordynminnis jordynminnis
  • 28-04-2020

Answer:

C. Karma and reincarnation

Explanation:

Hinduism focuses on the belief of things such as dharma and karma, which tie directly into reincarnation, as their worshippers attempt to reach what is called Nirvana.

Answer Link

Otras preguntas

Convert 3.2% to fraction and decimal notation..
. The compound Fe(NO3)3(s) is classified as a(n):?. a. polyatomic compound. b. molecular compound. c. ionic compound. d. multi-atomic compound
calculate the energy in joules and calories required to heat 25.0 g of water from 12.5C to 25.7C
EVALUATE cos(sin^-1(-5/13)) . answer using slash bar or fraction sign.
WHAT IS AN EVERYDAY EXAMPLE OF \"EXOCYTOSIS\"???? for example, mitochondrion creates energy so a household item or a 3D example of it would be a battery, since
Indicate in standard form the equation of the line passing through the given points. B(0, 0), C(4, -4) (I know y'all are not suppose to just give me the answers
John read the first 114 pages of a novel, which was 3 pages less than 1/3 of the novel. Write an equation to determine the total number of pages (p) in the nove
If there is a substance's effect like it impedes the binding of NAD+ to electrons, would you lose or gain weight and explain why.
Write the expression as either the sine, cosine, or tangent of a single angle. sin(pi/2)cos(pi/7)+cos(pi/2)sin(pi/7)
what is one benefit to lifelong physical activity