jennifergallegp38dgw jennifergallegp38dgw

27-01-2018
Mathematics

contestada

g(x)=x3+6x2+12x+8 when x=-1

Respuesta :

artisticwiz artisticwiz

27-01-2018

G=38
Whenever you divide or multiply by one the number stays the same, therefore just take out all the xs and then solve the equation. I hope this helps!

Answer Link

Otras preguntas

Let AB be a diameter of a circle, and let C be a point on the circle such that AC = 8 and BC = 6. The angle bisector of angle ACB intersects the circle at point

american writers tended to get (blank). a. a lot of honor and glory, but earned very little money b. a lot of honor, glory, and money c. very little honor, glor

c4h10o lewis structure

Choose the equation for which x = 5 is a solution

what is the missing reagent in the reaction belowCC(=O)c1ccccc1C=C(c1ccccc1)N(C)C

Which of the following is more likely to lead to a two-party system? a. a system without party activists b. a system with winner-take-all elections c. a proport

of 4 The time, T (seconds) it takes for a pot of water to boil is inversely proportional to the cooker setting, H, applied to the pot. When H = 8, T = 150. What

basic unit of carbohydrates

Determine the slope of the line given this two points ( 2, -4) and (2,6) with solution

Which of the following is not a unit of pressure? atmosphere psi [tex]\mathrm{N} / \mathrm{m}^2[/tex] [tex]\mathrm{mm}[/tex] of mercury pascal none of the above