britt109 britt109

01-09-2017
Mathematics

contestada

define a variable and write an inequality to model each situation. The school auditorium can seat at most 1200 people.

Respuesta :

kcyphers24 kcyphers24

01-09-2017

The picture is the answer

Ver imagen kcyphers24

Answer Link

Otras preguntas

You have just graduated from college and purchased a car for $8000. Your credit limit is $11,000. Assume that you make no payments and purchase nothing more and

What are the three domains of life? a.Plantae, Animalia, and Fungi b.class, kingdom, and phylum c.Eubacteria, family, and Eukarya d.Bacteria, Archaea, and Eukar

When products are shipped under a ______, the importer that accepts the draft is promising to pay the exporter at a specified future date. a. prepayment arrang

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

Explain why |−3| + |9| represents the distance between the points (−3, −5) and (9, −5). brainly

Hypnotic responsiveness is: a. the same in all people. b. generally greater in women than men. c. generally greater in men than women. d. greater when people ar

what would be the least effective detail for a description about a new amusement park/ Children sip lemonade and munch on popcorn tickets can be purchased in ad

What is the basic difference between additive manufacturing and rapid prototyping?

Mr. Ignacio went diving along the coral reef in Oahu. He descended 12 meters below sea level. The distance between this point on the coral reef and the highest

The measure of the smallest angle of a triangle is one-fifthfifth the measure of the largest angle. the measure of the second angle is 7373degrees° less than t