Janelle111 Janelle111

27-01-2017
Mathematics

contestada

There re 798 calories in 10 ounce bottles of apple juice how many clalories afe there i 10 ounce bottle of appe juice

Respuesta :

kimhyunseo03 kimhyunseo03

27-01-2017

798 calories..? because you just said it?

Answer Link

LukesTuke LukesTuke

27-01-2017

Isn't it still 798...?

Answer Link

Otras preguntas

What is the percentage of increase from 10 to 11

Can someone help me please What’s the answer to this Iready?

What type(s) of intermolecular forces are expected between 2-butanone _ molecules? CH;CH,Cch; Indicate with yes or no which apply: dipole forces induced dipole

Was the character's relationship an outcome of agency or fate? In Midnight Summers Dream please help me write a persuasive essay..

Identify the expected major product of the following reaction. [tex]\underset{\mathrm{H}_3 \mathrm{O}^{+}}{\longrightarrow}[/tex] ?CC(C)C(C)(O)COCC(O)C(C)(C)OCC

Which of the following names is correct? 3-butyl-4-pentene 3-ethyl-1-heptene 3-etheneheptane 5-ethyl-6-heptene All of these are correct.

A coin is tossed vertically upward and reaches a maximum height of 0.90 m before it comesback down. With what velocity was it thrown, and how long was it in the

2- The ball has a volume of 0.2m^3, find the buoyant force on it? (the ball is completely immersed in water) take g= 10 N/kg, density of water= 1000kg/m^3

Why was Fatte Jung Shah preferred by queen Rajya Laxmi for the post of Mukthiyar?

Find the scale factor and then solve for x. 40 A B 12, 100 B' CA' C' X