Seudónimo Seudónimo

20-06-2021
Arts

contestada

Why don't people compose very much classical music anymore. what happened and why did all the music become rap and rock? im so sad.

Respuesta :

RuSTy47 RuSTy47

20-06-2021

Answer:

Same bro/sis I am also very sad

Answer Link

ihavealazyeye16 ihavealazyeye16

21-06-2021

I’m not so sure, it sux tho

Answer Link

Otras preguntas

Part I. Write TRUE if the statement is correct and FALSE if it is incorrect. 1. Secondary storage devices store data and information permanently. 2. Random Acce

a/an diagnosis is also known as a rule out.

Learning Task 3: Take some time to learn about things that are currently happening around you. Watch news programs, listen to the radio, or read a newspaper. Af

HELP ASAP!!!2.) Sammy is creating a company called Dynamic-Sound to create the ultimate music listening experience. The function f(x) = 20x+x+ 50+ 30(x + 2) rep

what is the missing reagent in the reaction belowCC(=O)c1ccccc1C=C(c1ccccc1)N(C)C

work out the mean 7.6 ,8.9 3.8 , 4.4 ,2.6

Four states, X, Y, Z and W of a small country have populations as listed below. There are 100 seats in the legislature which must be apportioned to these states

Which describes a platform? an organized collection of data stored electronically on a local computer system or cloud a ready-to-use software package that perfo

Which of the following data types will be continuous? â€¢ The letter grades students received on a class quiz â€¢ The number of children younger than ten that v

By using the hair snare method, deer are sampled with replacement. Why is sampling with replacement a problem in this context, and how would the problem impact

ACCESS MORE EDU ACCESS