Roudhas
Roudhas Roudhas
  • 21-03-2021
  • Mathematics
contestada

I need help with this geometry question guyss!!

I need help with this geometry question guyss class=

Respuesta :

beatrizmushino
beatrizmushino beatrizmushino
  • 21-03-2021

Answer:

Step-by-step explanation:

If a quadrilateral is a parallelogram, then its opposite sides are congruent. If a quadrilateral is a parallelogram, then its opposite angles are congruent. If a quadrilateral is a parallelogram, then its diagonals bisect each other.

Ver imagen beatrizmushino
Answer Link

Otras preguntas

A student nurse looks at a patientâs chart and does not understand the meaning of serious sleep apnea, so she asks the head nurse for assistance. how might the
How does the missouri plan improve the judicial selection process in states that use it?
Which of these contraceptive methods would be most appropriaye for a female who wishes to avoid possible side effects? A. Intrauterine device B. Hormonal method
Southeast asia is divided into two major landforms they are
What is the slope of the line shown below?
8m/s from height of 4m into an equation
Find the area under the standard normal curve between z = -1.5 and z = 2.5
chlorofluorocarbons(CFCs) damage the ozone layer.Where do these chemicals come from?
The measure of one angle of a triangle is 115°. The other two angles are congruent. What is the measure of each angle? 115° 65° 57.5° 32.5°
If the temperature of a reaction is increased, the reaction proceeds at a much quicker rate because the