The combination of the monomers HOOCC6H4COOH and HOCH2CH2OH led to the formation of the polymer, COC1=C(C=CC(=C1)CC(=O)C(=O)O)O + H2O
What is structural formula?
Structural formula can be defined as those structures of a chemical compound that is made up of symbols of its elements which are connected by short lines that represent the chemical bonds.
The combination of Terephthalic Acid (HOOCC6H4COOH) and Ethylene Glycol (HOCH2CH2OH) will lead to the formation of Vanilpyruvic Acid (HOOCC6H4COOCH2CH2OH) and water. That is ,
Terephthalic Acid + Ethylene Glycol = Vanilpyruvic Acid + Water
The structural formula for Vanilpyruvic Acid is
COC1=C(C=CC(=C1)CC(=O)C(=O)O)O
Learn more about chemical formula here:
https://brainly.com/question/2778716
#SPJ1
