psic21mar psic21mar

04-02-2020
Social Studies

contestada

With compound interest, what happens when you start compounding more and more frequently?

Respuesta :

beingteenowfmao beingteenowfmao

04-02-2020

Answer:

Your money grows faster because the interest is added back into the principle and then the next time it compounds you get interest on the new principle amount.

Answer Link

Otras preguntas

Who made up the NATO?

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

A piggy bank contains only quarters and nickers and there is a total of 60 coins. The total value of the coins in the bank is 7.40$. How many quarters in the pi

One reason tundra plants are small and grow close to the ground is that _____.

Smooth muscles is something called visceral muscle because it. A. Lack striations B. Is voluntary C. Isn’t involved in movement D. Is found in organs

7 is 40% of what number

What is the slope-intercept form of the equation of a line that passes through (5, -4) and has a slope of 3/4?

Explain in terms of atoms why ch3ch2oh and ch3cho are not isomers of each other

a historian wants to compare the causes of death in the people of a particular civilzation. she wants to show each cause of death. which form of visual represen

Someone please help me ?