docrobinson68 docrobinson68

01-02-2020
Mathematics

contestada

Measurement of 1 and 2 are complementary.
1=x°
2= 3x+30°

Respuesta :

stupidboythink stupidboythink

01-02-2020

Answer:

15

Step-by-step explanation:

If two angles are complementary, they add up to 90 degrees.

So ∠1 + ∠2 = 90.

Which means that:

x + 3x + 30 = 90

Continue to simplify.

4x + 30 = 90

4x = 60

x = 15

The measure of angle 1 is 15.

90 - 15 = 75

The measure of angle 2 is 75.

Answer Link

Otras preguntas

why does eastern Norway have colder and snowier winters than western Norway?

what is 4 to the 6th power over 4 to the 8th power?

Which drug is used to lower blood pressure primarily via suppression of the renin-angiotensin-aldosterone system?

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

Write the complete balanced equation for the reaction between hydrochloric acid and magnesium hydroxide

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)

The population of a particular city is given by the function P(t) = 49,700(1.05)t, where t is time in years and P(t) is the population after t years. What is th

Given the equation 2x+2/y=4w+2 what is the value of x?

in which quadrant does the given point lie? (8,-1)

How can Write 5.04 in words