Question

What is the molecular equation for the reaction of solid calcium carbonate with aqueous acetic acid.

CaCO3(s)+2CH3COOH(aq) → Ca(CH3COO)2(aq)+H2O(l)+CO2(g)

CaCO3(s)+CH3COOH(aq) → CaCH3COO(aq)+H2O(l)+CO2(g)

CaCO3(s)+2CH3COOH(aq) → Ca(CH3COO)2(s)+H2O(l)+CO2(g)

CaCO3(s)+CH3COOH(aq) → CaCH3COO(s)+H2O(l)+CO2(g)

Answer 1

Answer:

The molecular equation for the reaction of CaCO₃ with CH₃COOH is:

CaCO₃ (s) + 2CH₃COOH (aq) → Ca(CH₃COO)₂ (aq) + H₂O (l) + CO₂ (g)

Option 1

Explanation:

CaCO₃ + 2CH₃COOH → Ca(CH₃COO)₂ + H₂O + CO₂

Option 3 is the same equation as option 1, but calcium acetate, does not precipitate, so the formed salt, is not a solid.

Option 2 and 4 are wrong because calcium acetate molecular formula is

Ca(CH₃COO)₂

Ca(CH₃COO)₂  → Ca²⁺  +   2 CH₃COO⁻

Answer 2

The molecular equation for the reaction of solid calcium carbonate with aqueous acetic acid is

A. $\rm CaCO_3(s)+2CH_3COOH(aq) = Ca(CH_3COO)^2(aq)+H_2O(l)+CO_2(g)$

What is calcium carbonate?

Calcium carbonate is a chemical compound that is found as mineral calcite in rocks.

$\rm CaCO_3(s)+2CH_3COOH(aq) = Ca(CH_3COO)^2(aq)+H_2O(l)+CO_2(g)$

1 mole of calcium carbonate is combined with 2 moles of acetic acid to produce 2 moles of calcium acetate and water.

Carbon dioxide is released as gas in the reaction.

Thus, the correct option is A.

Learn more about the molecular equations, here:

https://brainly.com/question/2094377