adelo77 adelo77
  • 03-11-2019
  • Mathematics
contestada

cosec(6b+pi/8)=sec(2b-pi/8)​

Respuesta :

2002hemal
2002hemal 2002hemal
  • 03-11-2019

Step-by-step explanation:

cosec( 6b+ pie/8)=sec(2b-pie/8)

1/ sin( 6b +pie/8)=1/sec(2b-pie/8)

cos(2b-pie/8)=sin(6b-pie/8)

cosX =sin(pie/2-x)

sin(pie/2-2b+pie/8)=sin(6b+pie/8)

pie/2-2b+pie/8=6b+pie/8

pie/2=8b

b = pie/16

Ver imagen 2002hemal
Answer Link

Otras preguntas

What is not the central bank's responsibility to control the amount of money circulating in the economy to address the unemployment problem?1. Reduction of inte
Which circuit-A or B-represents a series circuit? Explain your answer.
What is produced by the photosynthesis reaction? (2 points) A. Glucose only B. Carbon dioxide only C. Glucose and oxygen D. Glucose and carbon dioxide
Which expression is equivalent to x(x + 9) + 20 x + 5 ? A) x + 4 B) x + 5 C) x − 4 D) x − 5
Help me plssssssssssssssssssssssssssssssssssss
5. What is angel 8 use picture above
The sum of three squared and five squared
Flora is making salsa for a party. Every 1 cup of chopped tomatoes makes 2 3/4 cups of salsa. She uses 1 2/3 cups of tomatoes. How much salsa does she make? I
Can someone help me because I need help
How did American public opinion about the Soviet Union change after World War 2​